C27H23Cl2N5O2 — CID 135662194
7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662194) has the molecular formula C27H23Cl2N5O2 and a molecular weight of 520.42 g/mol. Its IUPAC name is 7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662194 |
| Molecular Formula | C27H23Cl2N5O2 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2)C(c2ccc(OCc3c(Cl)cccc3Cl)cc2)n2ncnc2N1 |
| InChI | InChI=1S/C27H23Cl2N5O2/c1-16-5-3-6-19(13-16)33-26(35)24-17(2)32-27-30-15-31-34(27)25(24)18-9-11-20(12-10-18)36-14-21-22(28)7-4-8-23(21)29/h3-13,15,25H,14H2,1-2H3,(H,33,35)(H,30,31,32) |
| InChIKey | RFNVPWONGTZTLW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |