C29H28ClN5O4 — CID 135578873
N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-[4-[(3-methylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135578873) has the molecular formula C29H28ClN5O4 and a molecular weight of 546.03 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-[4-[(3-methylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-[4-[(3-methylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135578873 |
| Molecular Formula | C29H28ClN5O4 |
| Molecular Weight | 546.03 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-[4-[(3-methylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(NC(=O)C2=C(C)Nc3ncnn3C2c2ccc(OCc3cccc(C)c3)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C29H28ClN5O4/c1-17-6-5-7-19(12-17)15-39-21-10-8-20(9-11-21)27-26(18(2)33-29-31-16-32-35(27)29)28(36)34-23-14-24(37-3)22(30)13-25(23)38-4/h5-14,16,27H,15H2,1-4H3,(H,34,36)(H,31,32,33) |
| InChIKey | DZBWZJXYLTWAEZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |