C22H22ClN5O3 — CID 136712949
(7S)-N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-(4-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136712949) has the molecular formula C22H22ClN5O3 and a molecular weight of 439.90 g/mol. Its IUPAC name is (7S)-N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-(4-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-(4-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136712949 |
| Molecular Formula | C22H22ClN5O3 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (7S)-N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-(4-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(NC(=O)C2=C(C)Nc3ncnn3[C@H]2c2ccc(C)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C22H22ClN5O3/c1-12-5-7-14(8-6-12)20-19(13(2)26-22-24-11-25-28(20)22)21(29)27-16-10-17(30-3)15(23)9-18(16)31-4/h5-11,20H,1-4H3,(H,27,29)(H,24,25,26)/t20-/m0/s1 |
| InChIKey | VRNJIRBDRIEAOD-FQEVSTJZSA-N |
| XLogP | 4.18 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |