C21H19ClFN5O3 — CID 136717041
(7R)-N-(4-chloro-2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136717041) has the molecular formula C21H19ClFN5O3 and a molecular weight of 443.87 g/mol. Its IUPAC name is (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136717041 |
| Molecular Formula | C21H19ClFN5O3 |
| Molecular Weight | 443.87 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(NC(=O)C2=C(C)Nc3ncnn3[C@@H]2c2ccc(F)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C21H19ClFN5O3/c1-11-18(20(29)27-15-9-16(30-2)14(22)8-17(15)31-3)19(12-4-6-13(23)7-5-12)28-21(26-11)24-10-25-28/h4-10,19H,1-3H3,(H,27,29)(H,24,25,26)/t19-/m1/s1 |
| InChIKey | JZYFOKXVYLGQHR-LJQANCHMSA-N |
| XLogP | 4.02 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |