C31H32ClN5O5 — CID 136800181
(7R)-N-(4-chloro-2,5-dimethoxyphenyl)-7-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136800181) has the molecular formula C31H32ClN5O5 and a molecular weight of 590.08 g/mol. Its IUPAC name is (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-7-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-7-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136800181 |
| Molecular Formula | C31H32ClN5O5 |
| Molecular Weight | 590.08 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-7-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1cc([C@@H]2C(C(=O)Nc3cc(OC)c(Cl)cc3OC)=C(C)Nc3ncnn32)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C31H32ClN5O5/c1-6-41-27-13-21(11-12-24(27)42-16-20-9-7-18(2)8-10-20)29-28(19(3)35-31-33-17-34-37(29)31)30(38)36-23-15-25(39-4)22(32)14-26(23)40-5/h7-15,17,29H,6,16H2,1-5H3,(H,36,38)(H,33,34,35)/t29-/m1/s1 |
| InChIKey | GKVJHWBNFNOFIC-GDLZYMKVSA-N |
| XLogP | 6.16 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.08 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |