C29H27Cl2N5O5 — CID 136800183
(7S)-N-(4-chloro-2,5-dimethoxyphenyl)-7-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136800183) has the molecular formula C29H27Cl2N5O5 and a molecular weight of 596.47 g/mol. Its IUPAC name is (7S)-N-(4-chloro-2,5-dimethoxyphenyl)-7-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-N-(4-chloro-2,5-dimethoxyphenyl)-7-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136800183 |
| Molecular Formula | C29H27Cl2N5O5 |
| Molecular Weight | 596.47 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | (7S)-N-(4-chloro-2,5-dimethoxyphenyl)-7-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(NC(=O)C2=C(C)Nc3ncnn3[C@H]2c2ccc(OCc3ccccc3Cl)c(OC)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C29H27Cl2N5O5/c1-16-26(28(37)35-21-13-23(38-2)20(31)12-24(21)39-3)27(36-29(34-16)32-15-33-36)17-9-10-22(25(11-17)40-4)41-14-18-7-5-6-8-19(18)30/h5-13,15,27H,14H2,1-4H3,(H,35,37)(H,32,33,34)/t27-/m0/s1 |
| InChIKey | VMBJCIRIKZXJPY-MHZLTWQESA-N |
| XLogP | 6.12 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |