C29H27Cl2N5O3 — CID 137158589
(7R)-7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-N-(2-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 137158589) has the molecular formula C29H27Cl2N5O3 and a molecular weight of 564.47 g/mol. Its IUPAC name is (7R)-7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-N-(2-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-N-(2-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 137158589 |
| Molecular Formula | C29H27Cl2N5O3 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | (7R)-7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-N-(2-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1cc([C@@H]2C(C(=O)Nc3ccccc3C)=C(C)Nc3ncnn32)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C29H27Cl2N5O3/c1-4-38-25-14-19(12-13-24(25)39-15-20-21(30)9-7-10-22(20)31)27-26(18(3)34-29-32-16-33-36(27)29)28(37)35-23-11-6-5-8-17(23)2/h5-14,16,27H,4,15H2,1-3H3,(H,35,37)(H,32,33,34)/t27-/m1/s1 |
| InChIKey | AECHECOIEXBFEQ-HHHXNRCGSA-N |
| XLogP | 6.80 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |