C33H35Cl2N5O3S — CID 135661919
7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(2,3-dimethylphenyl)-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135661919) has the molecular formula C33H35Cl2N5O3S and a molecular weight of 652.65 g/mol. Its IUPAC name is 7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(2,3-dimethylphenyl)-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(2,3-dimethylphenyl)-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135661919 |
| Molecular Formula | C33H35Cl2N5O3S |
| Molecular Weight | 652.65 g/mol |
| Exact Mass | 651.18 |
| IUPAC Name | 7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(2,3-dimethylphenyl)-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCSc1nc2n(n1)C(c1ccc(OCc3c(Cl)cccc3Cl)c(OCC)c1)C(C(=O)Nc1cccc(C)c1C)=C(C)N2 |
| InChI | InChI=1S/C33H35Cl2N5O3S/c1-6-16-44-33-38-32-36-21(5)29(31(41)37-26-13-8-10-19(3)20(26)4)30(40(32)39-33)22-14-15-27(28(17-22)42-7-2)43-18-23-24(34)11-9-12-25(23)35/h8-15,17,30H,6-7,16,18H2,1-5H3,(H,37,41)(H,36,38,39) |
| InChIKey | CCCRAVOQKKPNTB-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.65 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |