C34H37Cl2N5O4S — CID 135661921
2-butylsulfanyl-7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135661921) has the molecular formula C34H37Cl2N5O4S and a molecular weight of 682.67 g/mol. Its IUPAC name is 2-butylsulfanyl-7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-butylsulfanyl-7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135661921 |
| Molecular Formula | C34H37Cl2N5O4S |
| Molecular Weight | 682.67 g/mol |
| Exact Mass | 681.19 |
| IUPAC Name | 2-butylsulfanyl-7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(OCc3c(Cl)cccc3Cl)c(OCC)c1)C(C(=O)Nc1ccccc1OCC)=C(C)N2 |
| InChI | InChI=1S/C34H37Cl2N5O4S/c1-5-8-18-46-34-39-33-37-21(4)30(32(42)38-26-14-9-10-15-27(26)43-6-2)31(41(33)40-34)22-16-17-28(29(19-22)44-7-3)45-20-23-24(35)12-11-13-25(23)36/h9-17,19,31H,5-8,18,20H2,1-4H3,(H,38,42)(H,37,39,40) |
| InChIKey | VPJLOWQHWKFHHE-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.67 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|