C29H37N5O4S — CID 135660650
2-butylsulfanyl-7-(3,4-diethoxyphenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135660650) has the molecular formula C29H37N5O4S and a molecular weight of 551.71 g/mol. Its IUPAC name is 2-butylsulfanyl-7-(3,4-diethoxyphenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-butylsulfanyl-7-(3,4-diethoxyphenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135660650 |
| Molecular Formula | C29H37N5O4S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 2-butylsulfanyl-7-(3,4-diethoxyphenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(OCC)c(OCC)c1)C(C(=O)Nc1ccccc1OCC)=C(C)N2 |
| InChI | InChI=1S/C29H37N5O4S/c1-6-10-17-39-29-32-28-30-19(5)25(27(35)31-21-13-11-12-14-22(21)36-7-2)26(34(28)33-29)20-15-16-23(37-8-3)24(18-20)38-9-4/h11-16,18,26H,6-10,17H2,1-5H3,(H,31,35)(H,30,32,33) |
| InChIKey | ADYDIZHYNDFIIW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|