C37H45N5O4S — CID 135662101
2-butylsulfanyl-N-(2-ethoxyphenyl)-7-[3-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662101) has the molecular formula C37H45N5O4S and a molecular weight of 655.87 g/mol. Its IUPAC name is 2-butylsulfanyl-N-(2-ethoxyphenyl)-7-[3-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-butylsulfanyl-N-(2-ethoxyphenyl)-7-[3-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662101 |
| Molecular Formula | C37H45N5O4S |
| Molecular Weight | 655.87 g/mol |
| Exact Mass | 655.32 |
| IUPAC Name | 2-butylsulfanyl-N-(2-ethoxyphenyl)-7-[3-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(OCc3cc(C)c(C)cc3C)c(OCC)c1)C(C(=O)Nc1ccccc1OCC)=C(C)N2 |
| InChI | InChI=1S/C37H45N5O4S/c1-8-11-18-47-37-40-36-38-26(7)33(35(43)39-29-14-12-13-15-30(29)44-9-2)34(42(36)41-37)27-16-17-31(32(21-27)45-10-3)46-22-28-20-24(5)23(4)19-25(28)6/h12-17,19-21,34H,8-11,18,22H2,1-7H3,(H,39,43)(H,38,40,41) |
| InChIKey | URDRWQKXGRKKTI-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.87 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|