C32H34ClN5O3S — CID 135663568
2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663568) has the molecular formula C32H34ClN5O3S and a molecular weight of 604.18 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663568 |
| Molecular Formula | C32H34ClN5O3S |
| Molecular Weight | 604.18 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1ccc(C2C(C(=O)Nc3cccc(C)c3C)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc1OCC |
| InChI | InChI=1S/C32H34ClN5O3S/c1-6-40-26-16-15-22(17-27(26)41-7-2)29-28(30(39)35-25-14-10-11-19(3)20(25)4)21(5)34-31-36-32(37-38(29)31)42-18-23-12-8-9-13-24(23)33/h8-17,29H,6-7,18H2,1-5H3,(H,35,39)(H,34,36,37) |
| InChIKey | MFKMRWXLKMXVKW-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.18 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |