C32H34ClN5O4S — CID 135663569
2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663569) has the molecular formula C32H34ClN5O4S and a molecular weight of 620.18 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663569 |
| Molecular Formula | C32H34ClN5O4S |
| Molecular Weight | 620.18 g/mol |
| Exact Mass | 619.20 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1=C(C)Nc2nc(SCc3ccccc3Cl)nn2C1c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C32H34ClN5O4S/c1-5-40-25-15-11-10-14-24(25)35-30(39)28-20(4)34-31-36-32(43-19-22-12-8-9-13-23(22)33)37-38(31)29(28)21-16-17-26(41-6-2)27(18-21)42-7-3/h8-18,29H,5-7,19H2,1-4H3,(H,35,39)(H,34,36,37) |
| InChIKey | SCENXYSXYOPOKM-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.18 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |