C30H30ClN5O2S — CID 135663375
2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-7-(4-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663375) has the molecular formula C30H30ClN5O2S and a molecular weight of 560.12 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-7-(4-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-7-(4-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663375 |
| Molecular Formula | C30H30ClN5O2S |
| Molecular Weight | 560.12 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-7-(4-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1ccc(C2C(C(=O)Nc3cccc(C)c3C)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc1 |
| InChI | InChI=1S/C30H30ClN5O2S/c1-5-38-23-15-13-21(14-16-23)27-26(28(37)33-25-12-8-9-18(2)19(25)3)20(4)32-29-34-30(35-36(27)29)39-17-22-10-6-7-11-24(22)31/h6-16,27H,5,17H2,1-4H3,(H,33,37)(H,32,34,35) |
| InChIKey | QASFREYKADBAAL-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.12 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |