C32H34ClN5OS — CID 135663721
7-(4-tert-butylphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663721) has the molecular formula C32H34ClN5OS and a molecular weight of 572.18 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(4-tert-butylphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663721 |
| Molecular Formula | C32H34ClN5OS |
| Molecular Weight | 572.18 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 7-(4-tert-butylphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)C(c2ccc(C(C)(C)C)cc2)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C32H34ClN5OS/c1-19-10-9-13-26(20(19)2)35-29(39)27-21(3)34-30-36-31(40-18-23-11-7-8-12-25(23)33)37-38(30)28(27)22-14-16-24(17-15-22)32(4,5)6/h7-17,28H,18H2,1-6H3,(H,35,39)(H,34,36,37) |
| InChIKey | XIQAGZZKWVNKGQ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.18 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |