C32H28ClN5OS — CID 135663682
2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-5-methyl-7-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663682) has the molecular formula C32H28ClN5OS and a molecular weight of 566.13 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-5-methyl-7-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-5-methyl-7-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663682 |
| Molecular Formula | C32H28ClN5OS |
| Molecular Weight | 566.13 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylphenyl)-5-methyl-7-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)C(c2cccc3ccccc23)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C32H28ClN5OS/c1-19-10-8-17-27(20(19)2)35-30(39)28-21(3)34-31-36-32(40-18-23-12-5-7-16-26(23)33)37-38(31)29(28)25-15-9-13-22-11-4-6-14-24(22)25/h4-17,29H,18H2,1-3H3,(H,35,39)(H,34,36,37) |
| InChIKey | PCLOLMRSRWHLAW-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.13 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |