C29H37N5OS — CID 135660796
7-(4-tert-butylphenyl)-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135660796) has the molecular formula C29H37N5OS and a molecular weight of 503.72 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(4-tert-butylphenyl)-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135660796 |
| Molecular Formula | C29H37N5OS |
| Molecular Weight | 503.72 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 7-(4-tert-butylphenyl)-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(C(C)(C)C)cc1)C(C(=O)Nc1cccc(C)c1C)=C(C)N2 |
| InChI | InChI=1S/C29H37N5OS/c1-8-9-17-36-28-32-27-30-20(4)24(26(35)31-23-12-10-11-18(2)19(23)3)25(34(27)33-28)21-13-15-22(16-14-21)29(5,6)7/h10-16,25H,8-9,17H2,1-7H3,(H,31,35)(H,30,32,33) |
| InChIKey | SQNYCWNVQAKGAB-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|