C31H40BrN5O3S — CID 135661469
7-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135661469) has the molecular formula C31H40BrN5O3S and a molecular weight of 642.66 g/mol. Its IUPAC name is 7-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135661469 |
| Molecular Formula | C31H40BrN5O3S |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | 7-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCOc1c(Br)cc(C2C(C(=O)Nc3cccc(C)c3C)=C(C)Nc3nc(SCCCC)nn32)cc1OCC |
| InChI | InChI=1S/C31H40BrN5O3S/c1-7-10-15-40-28-23(32)17-22(18-25(28)39-9-3)27-26(29(38)34-24-14-12-13-19(4)20(24)5)21(6)33-30-35-31(36-37(27)30)41-16-11-8-2/h12-14,17-18,27H,7-11,15-16H2,1-6H3,(H,34,38)(H,33,35,36) |
| InChIKey | SIRSHKGHYPWCNN-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|