C34H38BrN5O3S — CID 135662008
7-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662008) has the molecular formula C34H38BrN5O3S and a molecular weight of 676.68 g/mol. Its IUPAC name is 7-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662008 |
| Molecular Formula | C34H38BrN5O3S |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 675.19 |
| IUPAC Name | 7-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(OCc3ccc(Br)cc3)c(OCC)c1)C(C(=O)Nc1cccc(C)c1C)=C(C)N2 |
| InChI | InChI=1S/C34H38BrN5O3S/c1-6-8-18-44-34-38-33-36-23(5)30(32(41)37-27-11-9-10-21(3)22(27)4)31(40(33)39-34)25-14-17-28(29(19-25)42-7-2)43-20-24-12-15-26(35)16-13-24/h9-17,19,31H,6-8,18,20H2,1-5H3,(H,37,41)(H,36,38,39) |
| InChIKey | FPRVPXQGTIPSFD-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|