C32H33BrClN5O2S — CID 135662694
7-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662694) has the molecular formula C32H33BrClN5O2S and a molecular weight of 667.07 g/mol. Its IUPAC name is 7-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662694 |
| Molecular Formula | C32H33BrClN5O2S |
| Molecular Weight | 667.07 g/mol |
| Exact Mass | 665.12 |
| IUPAC Name | 7-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1cc(Br)ccc1OCc1ccc(Cl)cc1)C(C(=O)Nc1cccc(C)c1C)=C(C)N2 |
| InChI | InChI=1S/C32H33BrClN5O2S/c1-5-6-16-42-32-37-31-35-21(4)28(30(40)36-26-9-7-8-19(2)20(26)3)29(39(31)38-32)25-17-23(33)12-15-27(25)41-18-22-10-13-24(34)14-11-22/h7-15,17,29H,5-6,16,18H2,1-4H3,(H,36,40)(H,35,37,38) |
| InChIKey | PFLCDHSDOBXMCK-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.07 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|