C25H28BrN5O3S — CID 135661426
7-(3-bromo-5-ethoxy-4-hydroxyphenyl)-N-(2,3-dimethylphenyl)-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135661426) has the molecular formula C25H28BrN5O3S and a molecular weight of 558.50 g/mol. Its IUPAC name is 7-(3-bromo-5-ethoxy-4-hydroxyphenyl)-N-(2,3-dimethylphenyl)-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3-bromo-5-ethoxy-4-hydroxyphenyl)-N-(2,3-dimethylphenyl)-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135661426 |
| Molecular Formula | C25H28BrN5O3S |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | 7-(3-bromo-5-ethoxy-4-hydroxyphenyl)-N-(2,3-dimethylphenyl)-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1cc(C2C(C(=O)Nc3cccc(C)c3C)=C(C)Nc3nc(SCC)nn32)cc(Br)c1O |
| InChI | InChI=1S/C25H28BrN5O3S/c1-6-34-19-12-16(11-17(26)22(19)32)21-20(23(33)28-18-10-8-9-13(3)14(18)4)15(5)27-24-29-25(35-7-2)30-31(21)24/h8-12,21,32H,6-7H2,1-5H3,(H,28,33)(H,27,29,30) |
| InChIKey | GGQLTIKDZAVPQJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |