C28H35N5OS — CID 135660191
2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-7-(4-propan-2-ylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135660191) has the molecular formula C28H35N5OS and a molecular weight of 489.69 g/mol. Its IUPAC name is 2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-7-(4-propan-2-ylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-7-(4-propan-2-ylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135660191 |
| Molecular Formula | C28H35N5OS |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-butylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-7-(4-propan-2-ylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(C(C)C)cc1)C(C(=O)Nc1cccc(C)c1C)=C(C)N2 |
| InChI | InChI=1S/C28H35N5OS/c1-7-8-16-35-28-31-27-29-20(6)24(26(34)30-23-11-9-10-18(4)19(23)5)25(33(27)32-28)22-14-12-21(13-15-22)17(2)3/h9-15,17,25H,7-8,16H2,1-6H3,(H,30,34)(H,29,31,32) |
| InChIKey | ZGXDWUQIDAKJMW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|