C27H23ClN6O3S — CID 135610750
2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-N-(2-methylphenyl)-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135610750) has the molecular formula C27H23ClN6O3S and a molecular weight of 547.04 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-N-(2-methylphenyl)-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-N-(2-methylphenyl)-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135610750 |
| Molecular Formula | C27H23ClN6O3S |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-N-(2-methylphenyl)-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2C)C(c2ccc([N+](=O)[O-])cc2)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C27H23ClN6O3S/c1-16-7-3-6-10-22(16)30-25(35)23-17(2)29-26-31-27(38-15-19-8-4-5-9-21(19)28)32-33(26)24(23)18-11-13-20(14-12-18)34(36)37/h3-14,24H,15H2,1-2H3,(H,30,35)(H,29,31,32) |
| InChIKey | UEVYTOWOLDTIDQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|