C21H18ClN5O3S — CID 135664741
1-[2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone (PubChem CID 135664741) has the molecular formula C21H18ClN5O3S and a molecular weight of 455.93 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone.
| Compound Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
|---|---|
| PubChem CID | 135664741 |
| Molecular Formula | C21H18ClN5O3S |
| Molecular Weight | 455.93 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
| SMILES | CC(=O)C1=C(C)Nc2nc(SCc3ccccc3Cl)nn2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18ClN5O3S/c1-12-18(13(2)28)19(14-7-9-16(10-8-14)27(29)30)26-20(23-12)24-21(25-26)31-11-15-5-3-4-6-17(15)22/h3-10,19H,11H2,1-2H3,(H,23,24,25) |
| InChIKey | AAXOJBITXMCCED-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|