C25H20ClN7O3S — CID 136719782
(7S)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(4-nitrophenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136719782) has the molecular formula C25H20ClN7O3S and a molecular weight of 534.00 g/mol. Its IUPAC name is (7S)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(4-nitrophenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(4-nitrophenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136719782 |
| Molecular Formula | C25H20ClN7O3S |
| Molecular Weight | 534.00 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | (7S)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(4-nitrophenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccnc2)[C@H](c2ccc([N+](=O)[O-])cc2)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C25H20ClN7O3S/c1-15-21(23(34)29-18-6-4-12-27-13-18)22(16-8-10-19(11-9-16)33(35)36)32-24(28-15)30-25(31-32)37-14-17-5-2-3-7-20(17)26/h2-13,22H,14H2,1H3,(H,29,34)(H,28,30,31)/t22-/m0/s1 |
| InChIKey | VQZYMJOHQOOLAF-QFIPXVFZSA-N |
| XLogP | 5.45 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.00 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|