C25H21N7O3S — CID 135579677
5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-N-phenyl-7-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135579677) has the molecular formula C25H21N7O3S and a molecular weight of 499.56 g/mol. Its IUPAC name is 5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-N-phenyl-7-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-N-phenyl-7-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135579677 |
| Molecular Formula | C25H21N7O3S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-N-phenyl-7-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2cccnc2)n2nc(SCc3ccc([N+](=O)[O-])cc3)nc2N1 |
| InChI | InChI=1S/C25H21N7O3S/c1-16-21(23(33)28-19-7-3-2-4-8-19)22(18-6-5-13-26-14-18)31-24(27-16)29-25(30-31)36-15-17-9-11-20(12-10-17)32(34)35/h2-14,22H,15H2,1H3,(H,28,33)(H,27,29,30) |
| InChIKey | CHRUOEKOBPRRIL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|