C22H21N5O4S — CID 156787258
ethyl 5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 156787258) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 156787258 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | ethyl 5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccc([N+](=O)[O-])cc3)nn2C1c1ccccc1 |
| InChI | InChI=1S/C22H21N5O4S/c1-3-31-20(28)18-14(2)23-21-24-22(25-26(21)19(18)16-7-5-4-6-8-16)32-13-15-9-11-17(12-10-15)27(29)30/h4-12,19H,3,13H2,1-2H3,(H,23,24,25) |
| InChIKey | VWTCCRHAOLYZPS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|