C22H19F2N5O4S — CID 4886305
ethyl 7-(3,5-difluorophenyl)-5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 4886305) has the molecular formula C22H19F2N5O4S and a molecular weight of 487.49 g/mol. Its IUPAC name is ethyl 7-(3,5-difluorophenyl)-5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(3,5-difluorophenyl)-5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4886305 |
| Molecular Formula | C22H19F2N5O4S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | ethyl 7-(3,5-difluorophenyl)-5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3cccc([N+](=O)[O-])c3)nn2C1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H19F2N5O4S/c1-3-33-20(30)18-12(2)25-21-26-22(34-11-13-5-4-6-17(7-13)29(31)32)27-28(21)19(18)14-8-15(23)10-16(24)9-14/h4-10,19H,3,11H2,1-2H3,(H,25,26,27) |
| InChIKey | ZMFZMJQWALBNMD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|