C22H20F2N4O2S — CID 4887247
ethyl 2-benzylsulfanyl-7-(3,5-difluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 4887247) has the molecular formula C22H20F2N4O2S and a molecular weight of 442.49 g/mol. Its IUPAC name is ethyl 2-benzylsulfanyl-7-(3,5-difluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-benzylsulfanyl-7-(3,5-difluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4887247 |
| Molecular Formula | C22H20F2N4O2S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | ethyl 2-benzylsulfanyl-7-(3,5-difluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccccc3)nn2C1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H20F2N4O2S/c1-3-30-20(29)18-13(2)25-21-26-22(31-12-14-7-5-4-6-8-14)27-28(21)19(18)15-9-16(23)11-17(24)10-15/h4-11,19H,3,12H2,1-2H3,(H,25,26,27) |
| InChIKey | HJNJFSBDLTVARS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |