C32H34N4O3S — CID 135792900
ethyl 2-benzylsulfanyl-5-methyl-7-[4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135792900) has the molecular formula C32H34N4O3S and a molecular weight of 554.72 g/mol. Its IUPAC name is ethyl 2-benzylsulfanyl-5-methyl-7-[4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-benzylsulfanyl-5-methyl-7-[4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135792900 |
| Molecular Formula | C32H34N4O3S |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | ethyl 2-benzylsulfanyl-5-methyl-7-[4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccccc3)nn2C1c1ccc(OCc2cc(C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C32H34N4O3S/c1-6-38-30(37)28-23(5)33-31-34-32(40-19-24-10-8-7-9-11-24)35-36(31)29(28)25-12-14-27(15-13-25)39-18-26-17-21(3)20(2)16-22(26)4/h7-17,29H,6,18-19H2,1-5H3,(H,33,34,35) |
| InChIKey | URLFGXNJOFEKAK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |