C33H36N4O3S — CID 135793167
benzyl 2-benzylsulfanyl-7-(4-hexoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135793167) has the molecular formula C33H36N4O3S and a molecular weight of 568.74 g/mol. Its IUPAC name is benzyl 2-benzylsulfanyl-7-(4-hexoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | benzyl 2-benzylsulfanyl-7-(4-hexoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135793167 |
| Molecular Formula | C33H36N4O3S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | benzyl 2-benzylsulfanyl-7-(4-hexoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCOc1ccc(C2C(C(=O)OCc3ccccc3)=C(C)Nc3nc(SCc4ccccc4)nn32)cc1 |
| InChI | InChI=1S/C33H36N4O3S/c1-3-4-5-12-21-39-28-19-17-27(18-20-28)30-29(31(38)40-22-25-13-8-6-9-14-25)24(2)34-32-35-33(36-37(30)32)41-23-26-15-10-7-11-16-26/h6-11,13-20,30H,3-5,12,21-23H2,1-2H3,(H,34,35,36) |
| InChIKey | SMMMOYFHQNGUFP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|