C27H32N4O3S — CID 135792972
propyl 2-benzylsulfanyl-7-(4-butoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135792972) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is propyl 2-benzylsulfanyl-7-(4-butoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | propyl 2-benzylsulfanyl-7-(4-butoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135792972 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | propyl 2-benzylsulfanyl-7-(4-butoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCOc1ccc(C2C(C(=O)OCCC)=C(C)Nc3nc(SCc4ccccc4)nn32)cc1 |
| InChI | InChI=1S/C27H32N4O3S/c1-4-6-17-33-22-14-12-21(13-15-22)24-23(25(32)34-16-5-2)19(3)28-26-29-27(30-31(24)26)35-18-20-10-8-7-9-11-20/h7-15,24H,4-6,16-18H2,1-3H3,(H,28,29,30) |
| InChIKey | DEKAIXNXVHHELW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|