C22H20BrN5O4S — CID 135936456
ethyl 7-(4-bromophenyl)-5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135936456) has the molecular formula C22H20BrN5O4S and a molecular weight of 530.40 g/mol. Its IUPAC name is ethyl 7-(4-bromophenyl)-5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(4-bromophenyl)-5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135936456 |
| Molecular Formula | C22H20BrN5O4S |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | ethyl 7-(4-bromophenyl)-5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccc([N+](=O)[O-])cc3)nn2C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrN5O4S/c1-3-32-20(29)18-13(2)24-21-25-22(33-12-14-4-10-17(11-5-14)28(30)31)26-27(21)19(18)15-6-8-16(23)9-7-15/h4-11,19H,3,12H2,1-2H3,(H,24,25,26) |
| InChIKey | JQTYERCYRLLBLK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|