C30H25BrN6O3S — CID 136900007
ethyl (7R)-7-(4-bromophenyl)-5-methyl-2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136900007) has the molecular formula C30H25BrN6O3S and a molecular weight of 629.54 g/mol. Its IUPAC name is ethyl (7R)-7-(4-bromophenyl)-5-methyl-2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (7R)-7-(4-bromophenyl)-5-methyl-2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136900007 |
| Molecular Formula | C30H25BrN6O3S |
| Molecular Weight | 629.54 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | ethyl (7R)-7-(4-bromophenyl)-5-methyl-2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccc(-c4nnc(-c5ccccc5)o4)cc3)nn2[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H25BrN6O3S/c1-3-39-28(38)24-18(2)32-29-33-30(36-37(29)25(24)20-13-15-23(31)16-14-20)41-17-19-9-11-22(12-10-19)27-35-34-26(40-27)21-7-5-4-6-8-21/h4-16,25H,3,17H2,1-2H3,(H,32,33,36)/t25-/m1/s1 |
| InChIKey | KIMSEBCDIYWYKH-RUZDIDTESA-N |
| XLogP | 6.90 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |