C32H29N5O4S — CID 135936415
ethyl 7-(4-methoxyphenyl)-5-methyl-2-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135936415) has the molecular formula C32H29N5O4S and a molecular weight of 579.68 g/mol. Its IUPAC name is ethyl 7-(4-methoxyphenyl)-5-methyl-2-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(4-methoxyphenyl)-5-methyl-2-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135936415 |
| Molecular Formula | C32H29N5O4S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | ethyl 7-(4-methoxyphenyl)-5-methyl-2-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccc(-c4ncc(-c5ccccc5)o4)cc3)nn2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H29N5O4S/c1-4-40-30(38)27-20(2)34-31-35-32(36-37(31)28(27)23-14-16-25(39-3)17-15-23)42-19-21-10-12-24(13-11-21)29-33-18-26(41-29)22-8-6-5-7-9-22/h5-18,28H,4,19H2,1-3H3,(H,34,35,36) |
| InChIKey | GSAQOLHJXOQMLX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |