C30H25N7O5S — CID 136900005
ethyl (7R)-5-methyl-7-(4-nitrophenyl)-2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136900005) has the molecular formula C30H25N7O5S and a molecular weight of 595.64 g/mol. Its IUPAC name is ethyl (7R)-5-methyl-7-(4-nitrophenyl)-2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (7R)-5-methyl-7-(4-nitrophenyl)-2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136900005 |
| Molecular Formula | C30H25N7O5S |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | ethyl (7R)-5-methyl-7-(4-nitrophenyl)-2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccc(-c4nnc(-c5ccccc5)o4)cc3)nn2[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H25N7O5S/c1-3-41-28(38)24-18(2)31-29-32-30(35-36(29)25(24)20-13-15-23(16-14-20)37(39)40)43-17-19-9-11-22(12-10-19)27-34-33-26(42-27)21-7-5-4-6-8-21/h4-16,25H,3,17H2,1-2H3,(H,31,32,35)/t25-/m1/s1 |
| InChIKey | YQUNWNFCVFMSCD-RUZDIDTESA-N |
| XLogP | 6.05 |
| TPSA | 151.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|