C21H20N6O4S — CID 135704133
7-(3-methoxyphenyl)-5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135704133) has the molecular formula C21H20N6O4S and a molecular weight of 452.50 g/mol. Its IUPAC name is 7-(3-methoxyphenyl)-5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3-methoxyphenyl)-5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135704133 |
| Molecular Formula | C21H20N6O4S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 7-(3-methoxyphenyl)-5-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cccc(C2C(C(N)=O)=C(C)Nc3nc(SCc4ccc([N+](=O)[O-])cc4)nn32)c1 |
| InChI | InChI=1S/C21H20N6O4S/c1-12-17(19(22)28)18(14-4-3-5-16(10-14)31-2)26-20(23-12)24-21(25-26)32-11-13-6-8-15(9-7-13)27(29)30/h3-10,18H,11H2,1-2H3,(H2,22,28)(H,23,24,25) |
| InChIKey | QALZQBSZAXPISK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|