C27H23N7O6S — CID 135594140
N-(2-methoxyphenyl)-5-methyl-7-(4-nitrophenyl)-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135594140) has the molecular formula C27H23N7O6S and a molecular weight of 573.59 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-5-methyl-7-(4-nitrophenyl)-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-5-methyl-7-(4-nitrophenyl)-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135594140 |
| Molecular Formula | C27H23N7O6S |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | N-(2-methoxyphenyl)-5-methyl-7-(4-nitrophenyl)-2-[(4-nitrophenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(SCc3ccc([N+](=O)[O-])cc3)nn2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H23N7O6S/c1-16-23(25(35)29-21-5-3-4-6-22(21)40-2)24(18-9-13-20(14-10-18)34(38)39)32-26(28-16)30-27(31-32)41-15-17-7-11-19(12-8-17)33(36)37/h3-14,24H,15H2,1-2H3,(H,29,35)(H,28,30,31) |
| InChIKey | FZBRHOPOUAAAJN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 167.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|