C26H22FN5OS — CID 135610760
2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N,7-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135610760) has the molecular formula C26H22FN5OS and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N,7-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N,7-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135610760 |
| Molecular Formula | C26H22FN5OS |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N,7-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccccc2)n2nc(SCc3ccccc3F)nc2N1 |
| InChI | InChI=1S/C26H22FN5OS/c1-17-22(24(33)29-20-13-6-3-7-14-20)23(18-10-4-2-5-11-18)32-25(28-17)30-26(31-32)34-16-19-12-8-9-15-21(19)27/h2-15,23H,16H2,1H3,(H,29,33)(H,28,30,31) |
| InChIKey | AOOQWIHNXMBVEF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |