C28H27N5OS — CID 136762513
(7R)-2-[(2,5-dimethylphenyl)methylsulfanyl]-5-methyl-N,7-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136762513) has the molecular formula C28H27N5OS and a molecular weight of 481.63 g/mol. Its IUPAC name is (7R)-2-[(2,5-dimethylphenyl)methylsulfanyl]-5-methyl-N,7-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-2-[(2,5-dimethylphenyl)methylsulfanyl]-5-methyl-N,7-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136762513 |
| Molecular Formula | C28H27N5OS |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (7R)-2-[(2,5-dimethylphenyl)methylsulfanyl]-5-methyl-N,7-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@@H](c2ccccc2)n2nc(SCc3cc(C)ccc3C)nc2N1 |
| InChI | InChI=1S/C28H27N5OS/c1-18-14-15-19(2)22(16-18)17-35-28-31-27-29-20(3)24(26(34)30-23-12-8-5-9-13-23)25(33(27)32-28)21-10-6-4-7-11-21/h4-16,25H,17H2,1-3H3,(H,30,34)(H,29,31,32)/t25-/m1/s1 |
| InChIKey | IPPONTFWKABEMJ-RUZDIDTESA-N |
| XLogP | 6.11 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |