C30H29N5O4S — CID 135936547
4-[2-[(2,4-dimethylphenyl)methylsulfanyl]-6-[(4-methoxyphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]benzoic acid (PubChem CID 135936547) has the molecular formula C30H29N5O4S and a molecular weight of 555.66 g/mol. Its IUPAC name is 4-[2-[(2,4-dimethylphenyl)methylsulfanyl]-6-[(4-methoxyphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]benzoic acid.
| Compound Name | 4-[2-[(2,4-dimethylphenyl)methylsulfanyl]-6-[(4-methoxyphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]benzoic acid |
|---|---|
| PubChem CID | 135936547 |
| Molecular Formula | C30H29N5O4S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 4-[2-[(2,4-dimethylphenyl)methylsulfanyl]-6-[(4-methoxyphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]benzoic acid |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3nc(SCc4ccc(C)cc4C)nn3C2c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H29N5O4S/c1-17-5-6-22(18(2)15-17)16-40-30-33-29-31-19(3)25(27(36)32-23-11-13-24(39-4)14-12-23)26(35(29)34-30)20-7-9-21(10-8-20)28(37)38/h5-15,26H,16H2,1-4H3,(H,32,36)(H,37,38)(H,31,33,34) |
| InChIKey | PLSLMMGCTJEXTN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |