C30H31N5O4S — CID 135936511
7-(2,5-dimethoxyphenyl)-N-(4-methoxyphenyl)-5-methyl-2-[(2-methylphenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135936511) has the molecular formula C30H31N5O4S and a molecular weight of 557.68 g/mol. Its IUPAC name is 7-(2,5-dimethoxyphenyl)-N-(4-methoxyphenyl)-5-methyl-2-[(2-methylphenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,5-dimethoxyphenyl)-N-(4-methoxyphenyl)-5-methyl-2-[(2-methylphenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135936511 |
| Molecular Formula | C30H31N5O4S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 7-(2,5-dimethoxyphenyl)-N-(4-methoxyphenyl)-5-methyl-2-[(2-methylphenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3nc(SCc4ccccc4C)nn3C2c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C30H31N5O4S/c1-18-8-6-7-9-20(18)17-40-30-33-29-31-19(2)26(28(36)32-21-10-12-22(37-3)13-11-21)27(35(29)34-30)24-16-23(38-4)14-15-25(24)39-5/h6-16,27H,17H2,1-5H3,(H,32,36)(H,31,33,34) |
| InChIKey | CRAJHDUYMNRIQW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |