C29H29N5O4S — CID 136688499
(7R)-2-benzylsulfanyl-7-(2,3-dimethoxyphenyl)-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136688499) has the molecular formula C29H29N5O4S and a molecular weight of 543.65 g/mol. Its IUPAC name is (7R)-2-benzylsulfanyl-7-(2,3-dimethoxyphenyl)-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-2-benzylsulfanyl-7-(2,3-dimethoxyphenyl)-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136688499 |
| Molecular Formula | C29H29N5O4S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | (7R)-2-benzylsulfanyl-7-(2,3-dimethoxyphenyl)-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3nc(SCc4ccccc4)nn3[C@@H]2c2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C29H29N5O4S/c1-18-24(27(35)31-20-13-15-21(36-2)16-14-20)25(22-11-8-12-23(37-3)26(22)38-4)34-28(30-18)32-29(33-34)39-17-19-9-6-5-7-10-19/h5-16,25H,17H2,1-4H3,(H,31,35)(H,30,32,33)/t25-/m1/s1 |
| InChIKey | ZJDKOVVRKJMUIA-RUZDIDTESA-N |
| XLogP | 5.52 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |