C29H28ClN5O2S — CID 136720208
(7S)-7-(2-chlorophenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136720208) has the molecular formula C29H28ClN5O2S and a molecular weight of 546.10 g/mol. Its IUPAC name is (7S)-7-(2-chlorophenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-7-(2-chlorophenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136720208 |
| Molecular Formula | C29H28ClN5O2S |
| Molecular Weight | 546.10 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | (7S)-7-(2-chlorophenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3nc(SCc4ccc(C)cc4C)nn3[C@@H]2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C29H28ClN5O2S/c1-17-9-10-20(18(2)15-17)16-38-29-33-28-31-19(3)25(27(36)32-21-11-13-22(37-4)14-12-21)26(35(28)34-29)23-7-5-6-8-24(23)30/h5-15,26H,16H2,1-4H3,(H,32,36)(H,31,33,34)/t26-/m1/s1 |
| InChIKey | XDZXSNGJUSZEOR-AREMUKBSSA-N |
| XLogP | 6.78 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.10 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |