C25H29N5O3S — CID 135656508
N,7-bis(4-methoxyphenyl)-5-methyl-2-(2-methylpropylsulfanyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135656508) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is N,7-bis(4-methoxyphenyl)-5-methyl-2-(2-methylpropylsulfanyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N,7-bis(4-methoxyphenyl)-5-methyl-2-(2-methylpropylsulfanyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135656508 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N,7-bis(4-methoxyphenyl)-5-methyl-2-(2-methylpropylsulfanyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3nc(SCC(C)C)nn3C2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H29N5O3S/c1-15(2)14-34-25-28-24-26-16(3)21(23(31)27-18-8-12-20(33-5)13-9-18)22(30(24)29-25)17-6-10-19(32-4)11-7-17/h6-13,15,22H,14H2,1-5H3,(H,27,31)(H,26,28,29) |
| InChIKey | AAYJBUKJMDIPTL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |