C26H20Cl3N5OS — CID 3449443
N,7-bis(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 3449443) has the molecular formula C26H20Cl3N5OS and a molecular weight of 556.91 g/mol. Its IUPAC name is N,7-bis(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N,7-bis(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 3449443 |
| Molecular Formula | C26H20Cl3N5OS |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | N,7-bis(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(Cl)cc2)C(c2ccc(Cl)cc2)n2nc(SCc3ccc(Cl)cc3)nc2N1 |
| InChI | InChI=1S/C26H20Cl3N5OS/c1-15-22(24(35)31-21-12-10-20(29)11-13-21)23(17-4-8-19(28)9-5-17)34-25(30-15)32-26(33-34)36-14-16-2-6-18(27)7-3-16/h2-13,23H,14H2,1H3,(H,31,35)(H,30,32,33) |
| InChIKey | LLHHIXHNSZRMOB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |