C30H29ClN6O2S — CID 136720256
(7R)-7-(4-acetamidophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136720256) has the molecular formula C30H29ClN6O2S and a molecular weight of 573.12 g/mol. Its IUPAC name is (7R)-7-(4-acetamidophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-7-(4-acetamidophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136720256 |
| Molecular Formula | C30H29ClN6O2S |
| Molecular Weight | 573.12 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | (7R)-7-(4-acetamidophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC(=O)Nc1ccc([C@@H]2C(C(=O)Nc3ccc(C)cc3C)=C(C)Nc3nc(SCc4ccc(Cl)cc4)nn32)cc1 |
| InChI | InChI=1S/C30H29ClN6O2S/c1-17-5-14-25(18(2)15-17)34-28(39)26-19(3)32-29-35-30(40-16-21-6-10-23(31)11-7-21)36-37(29)27(26)22-8-12-24(13-9-22)33-20(4)38/h5-15,27H,16H2,1-4H3,(H,33,38)(H,34,39)(H,32,35,36)/t27-/m1/s1 |
| InChIKey | BSHFHQJGIMSHOV-HHHXNRCGSA-N |
| XLogP | 6.73 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.12 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |