C26H24ClN5OS2 — CID 135419090
2-[(4-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135419090) has the molecular formula C26H24ClN5OS2 and a molecular weight of 522.10 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135419090 |
| Molecular Formula | C26H24ClN5OS2 |
| Molecular Weight | 522.10 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2cccs2)n2nc(SCc3ccc(Cl)cc3)nc2N1 |
| InChI | InChI=1S/C26H24ClN5OS2/c1-15-6-11-20(16(2)13-15)29-24(33)22-17(3)28-25-30-26(35-14-18-7-9-19(27)10-8-18)31-32(25)23(22)21-5-4-12-34-21/h4-13,23H,14H2,1-3H3,(H,29,33)(H,28,30,31) |
| InChIKey | PFPLRPHILNPNNM-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.10 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |