C35H31Cl2N5O2S — CID 135793242
2-benzylsulfanyl-7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135793242) has the molecular formula C35H31Cl2N5O2S and a molecular weight of 656.64 g/mol. Its IUPAC name is 2-benzylsulfanyl-7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-benzylsulfanyl-7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135793242 |
| Molecular Formula | C35H31Cl2N5O2S |
| Molecular Weight | 656.64 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | 2-benzylsulfanyl-7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc(OCc3c(Cl)cccc3Cl)cc2)n2nc(SCc3ccccc3)nc2N1 |
| InChI | InChI=1S/C35H31Cl2N5O2S/c1-21-12-17-30(22(2)18-21)39-33(43)31-23(3)38-34-40-35(45-20-24-8-5-4-6-9-24)41-42(34)32(31)25-13-15-26(16-14-25)44-19-27-28(36)10-7-11-29(27)37/h4-18,32H,19-20H2,1-3H3,(H,39,43)(H,38,40,41) |
| InChIKey | REYKNZHMTMXIDQ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.64 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |