C28H26ClN5OS — CID 135876698
2-benzylsulfanyl-7-(3-chlorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135876698) has the molecular formula C28H26ClN5OS and a molecular weight of 516.07 g/mol. Its IUPAC name is 2-benzylsulfanyl-7-(3-chlorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-benzylsulfanyl-7-(3-chlorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135876698 |
| Molecular Formula | C28H26ClN5OS |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 2-benzylsulfanyl-7-(3-chlorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2cccc(Cl)c2)n2nc(SCc3ccccc3)nc2N1 |
| InChI | InChI=1S/C28H26ClN5OS/c1-17-12-13-23(18(2)14-17)31-26(35)24-19(3)30-27-32-28(36-16-20-8-5-4-6-9-20)33-34(27)25(24)21-10-7-11-22(29)15-21/h4-15,25H,16H2,1-3H3,(H,31,35)(H,30,32,33) |
| InChIKey | POPCTSWXGIDERH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |